C19H26N2O3 — CID 124887284
1-[(5R,9R)-2,6-dioxaspiro[4.5]decan-9-yl]-3-(3-phenylcyclobutyl)urea (PubChem CID 124887284) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-[(5R,9R)-2,6-dioxaspiro[4.5]decan-9-yl]-3-(3-phenylcyclobutyl)urea.
| Compound Name | 1-[(5R,9R)-2,6-dioxaspiro[4.5]decan-9-yl]-3-(3-phenylcyclobutyl)urea |
|---|---|
| PubChem CID | 124887284 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-[(5R,9R)-2,6-dioxaspiro[4.5]decan-9-yl]-3-(3-phenylcyclobutyl)urea |
| SMILES | O=C(NC1CC(c2ccccc2)C1)N[C@@H]1CCO[C@@]2(CCOC2)C1 |
| InChI | InChI=1S/C19H26N2O3/c22-18(20-16-6-8-24-19(12-16)7-9-23-13-19)21-17-10-15(11-17)14-4-2-1-3-5-14/h1-5,15-17H,6-13H2,(H2,20,21,22)/t15?,16-,17?,19+/m1/s1 |
| InChIKey | RLCWTSBRLGAGOD-AFNJWWOFSA-N |
| XLogP | 2.57 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |