C19H24N2O2 — CID 124888269
1-[(2R)-2-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)pyrrolidin-1-yl]-2-phenylethanone (PubChem CID 124888269) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-[(2R)-2-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)pyrrolidin-1-yl]-2-phenylethanone.
| Compound Name | 1-[(2R)-2-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)pyrrolidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 124888269 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-[(2R)-2-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)pyrrolidin-1-yl]-2-phenylethanone |
| SMILES | CC1=CCCN(C(=O)[C@H]2CCCN2C(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H24N2O2/c1-15-7-5-11-20(14-15)19(23)17-10-6-12-21(17)18(22)13-16-8-3-2-4-9-16/h2-4,7-9,17H,5-6,10-14H2,1H3/t17-/m1/s1 |
| InChIKey | VUQJWQJOKODMDX-QGZVFWFLSA-N |
| XLogP | 2.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|