C17H21N3O2 — CID 124888888
(1S)-N-[(1S)-1-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]cyclohex-2-en-1-amine (PubChem CID 124888888) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is (1S)-N-[(1S)-1-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]cyclohex-2-en-1-amine.
| Compound Name | (1S)-N-[(1S)-1-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 124888888 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | (1S)-N-[(1S)-1-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]cyclohex-2-en-1-amine |
| SMILES | COc1ccccc1-c1noc([C@H](C)N[C@@H]2C=CCCC2)n1 |
| InChI | InChI=1S/C17H21N3O2/c1-12(18-13-8-4-3-5-9-13)17-19-16(20-22-17)14-10-6-7-11-15(14)21-2/h4,6-8,10-13,18H,3,5,9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | TZYTXXYUILMGCZ-QWHCGFSZSA-N |
| XLogP | 3.50 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|