C19H21N5O — CID 124889362
(2-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]methanone (PubChem CID 124889362) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is (2-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]methanone.
| Compound Name | (2-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]methanone |
|---|---|
| PubChem CID | 124889362 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (2-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]methanone |
| SMILES | Cc1nc2nccc(C(=O)N3c4ccccc4[C@@H](C)CC3(C)C)n2n1 |
| InChI | InChI=1S/C19H21N5O/c1-12-11-19(3,4)23(15-8-6-5-7-14(12)15)17(25)16-9-10-20-18-21-13(2)22-24(16)18/h5-10,12H,11H2,1-4H3/t12-/m0/s1 |
| InChIKey | XJWZTSKCIMGVFW-LBPRGKRZSA-N |
| XLogP | 3.37 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |