About 3-[(1S,6R)-6-methyl-1-oxo-1,4-thiazepan-4-yl]-1-(4-methylphenyl)propan-1-one
3-[(1S,6R)-6-methyl-1-oxo-1,4-thiazepan-4-yl]-1-(4-methylphenyl)propan-1-one (PubChem CID 124889612) has the molecular formula C16H23NO2S
and a molecular weight of 293.43 g/mol. Its IUPAC name is 3-[(1S,6R)-6-methyl-1-oxo-1,4-thiazepan-4-yl]-1-(4-methylphenyl)propan-1-one.
Molecular Properties
| Compound Name | 3-[(1S,6R)-6-methyl-1-oxo-1,4-thiazepan-4-yl]-1-(4-methylphenyl)propan-1-one |
| PubChem CID | 124889612 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-[(1S,6R)-6-methyl-1-oxo-1,4-thiazepan-4-yl]-1-(4-methylphenyl)propan-1-one |
| SMILES | Cc1ccc(C(=O)CCN2CC[S@@](=O)C[C@H](C)C2)cc1 |
| InChI | InChI=1S/C16H23NO2S/c1-13-3-5-15(6-4-13)16(18)7-8-17-9-10-20(19)12-14(2)11-17/h3-6,14H,7-12H2,1-2H3/t14-,20-/m1/s1 |
| InChIKey | VVMOQKJANZUROF-JLTOFOAXSA-N |
| XLogP | 2.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1S,6R)-6-methyl-1-oxo-1,4-thiazepan-4-yl]-1-(4-methylphenyl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S,6R)-6-methyl-1-oxo-1,4-thiazepan-4-yl]-1-(4-methylphenyl)propan-1-one?
The IUPAC name of 3-[(1S,6R)-6-methyl-1-oxo-1,4-thiazepan-4-yl]-1-(4-methylphenyl)propan-1-one (CID 124889612) is 3-[(1S,6R)-6-methyl-1-oxo-1,4-thiazepan-4-yl]-1-(4-methylphenyl)propan-1-one.
What is the SMILES notation for 3-[(1S,6R)-6-methyl-1-oxo-1,4-thiazepan-4-yl]-1-(4-methylphenyl)propan-1-one?
The canonical SMILES for 3-[(1S,6R)-6-methyl-1-oxo-1,4-thiazepan-4-yl]-1-(4-methylphenyl)propan-1-one is Cc1ccc(C(=O)CCN2CC[S@@](=O)C[C@H](C)C2)cc1.
What is the InChIKey of 3-[(1S,6R)-6-methyl-1-oxo-1,4-thiazepan-4-yl]-1-(4-methylphenyl)propan-1-one?
The InChIKey is VVMOQKJANZUROF-JLTOFOAXSA-N. The full InChI is InChI=1S/C16H23NO2S/c1-13-3-5-15(6-4-13)16(18)7-8-17-9-10-20(19)12-14(2)11-17/h3-6,14H,7-12H2,1-2H3/t14-,20-/m1/s1.
What are the key properties of 3-[(1S,6R)-6-methyl-1-oxo-1,4-thiazepan-4-yl]-1-(4-methylphenyl)propan-1-one?
3-[(1S,6R)-6-methyl-1-oxo-1,4-thiazepan-4-yl]-1-(4-methylphenyl)propan-1-one has a molecular weight of 293.43 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S,6R)-6-methyl-1-oxo-1,4-thiazepan-4-yl]-1-(4-methylphenyl)propan-1-one is sourced from PubChem (CID 124889612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).