C18H18FN5O2S — CID 124890507
(2R)-N'-(4-fluoro-2-methoxyphenyl)-1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbohydrazide (PubChem CID 124890507) has the molecular formula C18H18FN5O2S and a molecular weight of 387.44 g/mol. Its IUPAC name is (2R)-N'-(4-fluoro-2-methoxyphenyl)-1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbohydrazide.
| Compound Name | (2R)-N'-(4-fluoro-2-methoxyphenyl)-1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 124890507 |
| Molecular Formula | C18H18FN5O2S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | (2R)-N'-(4-fluoro-2-methoxyphenyl)-1-thieno[2,3-d]pyrimidin-4-ylpyrrolidine-2-carbohydrazide |
| SMILES | COc1cc(F)ccc1NNC(=O)[C@H]1CCCN1c1ncnc2sccc12 |
| InChI | InChI=1S/C18H18FN5O2S/c1-26-15-9-11(19)4-5-13(15)22-23-17(25)14-3-2-7-24(14)16-12-6-8-27-18(12)21-10-20-16/h4-6,8-10,14,22H,2-3,7H2,1H3,(H,23,25)/t14-/m1/s1 |
| InChIKey | VPQZMKHHNDFMEN-CQSZACIVSA-N |
| XLogP | 2.95 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|