C15H18F3NO — CID 124890583
3,3-difluoro-1-[(2R)-2-(4-fluorophenyl)piperidin-1-yl]butan-1-one (PubChem CID 124890583) has the molecular formula C15H18F3NO and a molecular weight of 285.31 g/mol. Its IUPAC name is 3,3-difluoro-1-[(2R)-2-(4-fluorophenyl)piperidin-1-yl]butan-1-one.
| Compound Name | 3,3-difluoro-1-[(2R)-2-(4-fluorophenyl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 124890583 |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3,3-difluoro-1-[(2R)-2-(4-fluorophenyl)piperidin-1-yl]butan-1-one |
| SMILES | CC(F)(F)CC(=O)N1CCCC[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H18F3NO/c1-15(17,18)10-14(20)19-9-3-2-4-13(19)11-5-7-12(16)8-6-11/h5-8,13H,2-4,9-10H2,1H3/t13-/m1/s1 |
| InChIKey | WTCZFVKQBOCBRG-CYBMUJFWSA-N |
| XLogP | 3.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |