C15H17F3N4O2 — CID 124890657
2,4-dimethyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,3-oxazole-5-carboxamide (PubChem CID 124890657) has the molecular formula C15H17F3N4O2 and a molecular weight of 342.32 g/mol. Its IUPAC name is 2,4-dimethyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,3-oxazole-5-carboxamide.
| Compound Name | 2,4-dimethyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 124890657 |
| Molecular Formula | C15H17F3N4O2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2,4-dimethyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)NC[C@@H]2CCc3nc(C(F)(F)F)cn3C2)o1 |
| InChI | InChI=1S/C15H17F3N4O2/c1-8-13(24-9(2)20-8)14(23)19-5-10-3-4-12-21-11(15(16,17)18)7-22(12)6-10/h7,10H,3-6H2,1-2H3,(H,19,23)/t10-/m0/s1 |
| InChIKey | YAPGMNUWUINZAH-JTQLQIEISA-N |
| XLogP | 2.50 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |