C18H14ClFN2O4S — CID 124891179
N'-(3-chloro-4-fluorophenyl)-N-[(2S)-2-(furan-2-yl)-2-hydroxy-2-thiophen-3-ylethyl]oxamide (PubChem CID 124891179) has the molecular formula C18H14ClFN2O4S and a molecular weight of 408.84 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-[(2S)-2-(furan-2-yl)-2-hydroxy-2-thiophen-3-ylethyl]oxamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-[(2S)-2-(furan-2-yl)-2-hydroxy-2-thiophen-3-ylethyl]oxamide |
|---|---|
| PubChem CID | 124891179 |
| Molecular Formula | C18H14ClFN2O4S |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-[(2S)-2-(furan-2-yl)-2-hydroxy-2-thiophen-3-ylethyl]oxamide |
| SMILES | O=C(NC[C@@](O)(c1ccsc1)c1ccco1)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H14ClFN2O4S/c19-13-8-12(3-4-14(13)20)22-17(24)16(23)21-10-18(25,11-5-7-27-9-11)15-2-1-6-26-15/h1-9,25H,10H2,(H,21,23)(H,22,24)/t18-/m1/s1 |
| InChIKey | AXJUQYWFOSKNGS-GOSISDBHSA-N |
| XLogP | 3.12 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|