C27H35NO4 — CID 124891614
ethyl (2Z)-2-[(3R,3aR,6'R,7aR)-6'-(2-methoxy-5-methylphenyl)-1',7a-dimethyl-4'-oxospiro[1,3a,4,5,6,7-hexahydroindole-3,3'-cyclohexene]-2-ylidene]acetate (PubChem CID 124891614) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is ethyl (2Z)-2-[(3R,3aR,6'R,7aR)-6'-(2-methoxy-5-methylphenyl)-1',7a-dimethyl-4'-oxospiro[1,3a,4,5,6,7-hexahydroindole-3,3'-cyclohexene]-2-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(3R,3aR,6'R,7aR)-6'-(2-methoxy-5-methylphenyl)-1',7a-dimethyl-4'-oxospiro[1,3a,4,5,6,7-hexahydroindole-3,3'-cyclohexene]-2-ylidene]acetate |
|---|---|
| PubChem CID | 124891614 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | ethyl (2Z)-2-[(3R,3aR,6'R,7aR)-6'-(2-methoxy-5-methylphenyl)-1',7a-dimethyl-4'-oxospiro[1,3a,4,5,6,7-hexahydroindole-3,3'-cyclohexene]-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\N[C@]2(C)CCCC[C@@H]2[C@]12C=C(C)[C@H](c1cc(C)ccc1OC)CC2=O |
| InChI | InChI=1S/C27H35NO4/c1-6-32-25(30)15-23-27(22-9-7-8-12-26(22,4)28-23)16-18(3)19(14-24(27)29)20-13-17(2)10-11-21(20)31-5/h10-11,13,15-16,19,22,28H,6-9,12,14H2,1-5H3/b23-15-/t19-,22+,26-,27-/m1/s1 |
| InChIKey | WQVSDWDDNOWAJV-WRSHRIPBSA-N |
| XLogP | 4.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|