C20H20FN3O4 — CID 124891907
(E)-3-(1,3-benzodioxol-5-yl)-1-[(3R)-3-(6-ethyl-5-fluoropyrimidin-4-yl)oxypyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 124891907) has the molecular formula C20H20FN3O4 and a molecular weight of 385.40 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-[(3R)-3-(6-ethyl-5-fluoropyrimidin-4-yl)oxypyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[(3R)-3-(6-ethyl-5-fluoropyrimidin-4-yl)oxypyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 124891907 |
| Molecular Formula | C20H20FN3O4 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[(3R)-3-(6-ethyl-5-fluoropyrimidin-4-yl)oxypyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | CCc1ncnc(O[C@@H]2CCN(C(=O)/C=C/c3ccc4c(c3)OCO4)C2)c1F |
| InChI | InChI=1S/C20H20FN3O4/c1-2-15-19(21)20(23-11-22-15)28-14-7-8-24(10-14)18(25)6-4-13-3-5-16-17(9-13)27-12-26-16/h3-6,9,11,14H,2,7-8,10,12H2,1H3/b6-4+/t14-/m1/s1 |
| InChIKey | JSBLCFOJFSDCLV-YVARQFDVSA-N |
| XLogP | 2.60 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|