C11H16FN3O3S — CID 124892553
4-ethyl-5-fluoro-6-[(3S)-1-methylsulfonylpyrrolidin-3-yl]oxypyrimidine (PubChem CID 124892553) has the molecular formula C11H16FN3O3S and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-ethyl-5-fluoro-6-[(3S)-1-methylsulfonylpyrrolidin-3-yl]oxypyrimidine.
| Compound Name | 4-ethyl-5-fluoro-6-[(3S)-1-methylsulfonylpyrrolidin-3-yl]oxypyrimidine |
|---|---|
| PubChem CID | 124892553 |
| Molecular Formula | C11H16FN3O3S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-ethyl-5-fluoro-6-[(3S)-1-methylsulfonylpyrrolidin-3-yl]oxypyrimidine |
| SMILES | CCc1ncnc(O[C@H]2CCN(S(C)(=O)=O)C2)c1F |
| InChI | InChI=1S/C11H16FN3O3S/c1-3-9-10(12)11(14-7-13-9)18-8-4-5-15(6-8)19(2,16)17/h7-8H,3-6H2,1-2H3/t8-/m0/s1 |
| InChIKey | SPLQCZUSNJOUNR-QMMMGPOBSA-N |
| XLogP | 0.59 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |