C16H24N2O2 — CID 124894653
(3aR,6R,7aS)-5,7a-ditert-butylspiro[3,3a-dihydroindazole-6,2'-oxirane]-7-one (PubChem CID 124894653) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (3aR,6R,7aS)-5,7a-ditert-butylspiro[3,3a-dihydroindazole-6,2'-oxirane]-7-one.
| Compound Name | (3aR,6R,7aS)-5,7a-ditert-butylspiro[3,3a-dihydroindazole-6,2'-oxirane]-7-one |
|---|---|
| PubChem CID | 124894653 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (3aR,6R,7aS)-5,7a-ditert-butylspiro[3,3a-dihydroindazole-6,2'-oxirane]-7-one |
| SMILES | CC(C)(C)C1=C[C@@H]2CN=N[C@@]2(C(C)(C)C)C(=O)[C@]12CO2 |
| InChI | InChI=1S/C16H24N2O2/c1-13(2,3)11-7-10-8-17-18-16(10,14(4,5)6)12(19)15(11)9-20-15/h7,10H,8-9H2,1-6H3/t10-,15+,16-/m1/s1 |
| InChIKey | OZXNBXFXQYOLPI-HPEXNQPKSA-N |
| XLogP | 3.18 |
| TPSA | 54.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|