C34H24N4O4 — CID 124895029
2-[2-[(2'R,3R,3'S,10'bS)-2-oxo-2'-(pyridine-4-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenoxy]acetonitrile (PubChem CID 124895029) has the molecular formula C34H24N4O4 and a molecular weight of 552.59 g/mol. Its IUPAC name is 2-[2-[(2'R,3R,3'S,10'bS)-2-oxo-2'-(pyridine-4-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-[(2'R,3R,3'S,10'bS)-2-oxo-2'-(pyridine-4-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 124895029 |
| Molecular Formula | C34H24N4O4 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 2-[2-[(2'R,3R,3'S,10'bS)-2-oxo-2'-(pyridine-4-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-3'-carbonyl]phenoxy]acetonitrile |
| SMILES | N#CCOc1ccccc1C(=O)[C@@H]1[C@H](C(=O)c2ccncc2)[C@]2(C(=O)Nc3ccccc32)[C@@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C34H24N4O4/c35-16-20-42-27-12-6-3-9-24(27)31(40)29-28(30(39)22-13-17-36-18-14-22)34(25-10-4-5-11-26(25)37-33(34)41)32-23-8-2-1-7-21(23)15-19-38(29)32/h1-15,17-19,28-29,32H,20H2,(H,37,41)/t28-,29+,32+,34+/m1/s1 |
| InChIKey | ZAZCTYJSEIKFAA-YRAGKPRHSA-N |
| XLogP | 4.97 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |