C13H24N2O3S — CID 124895360
(7S,8aS)-7-(cyclopropylmethoxy)-2-ethylsulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 124895360) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is (7S,8aS)-7-(cyclopropylmethoxy)-2-ethylsulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (7S,8aS)-7-(cyclopropylmethoxy)-2-ethylsulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 124895360 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (7S,8aS)-7-(cyclopropylmethoxy)-2-ethylsulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CCS(=O)(=O)N1CCN2C[C@@H](OCC3CC3)C[C@H]2C1 |
| InChI | InChI=1S/C13H24N2O3S/c1-2-19(16,17)15-6-5-14-9-13(7-12(14)8-15)18-10-11-3-4-11/h11-13H,2-10H2,1H3/t12-,13-/m0/s1 |
| InChIKey | HPVBSMKDWJQRSM-STQMWFEESA-N |
| XLogP | 0.52 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |