C13H19FN4O3S — CID 124895371
N-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide (PubChem CID 124895371) has the molecular formula C13H19FN4O3S and a molecular weight of 330.39 g/mol. Its IUPAC name is N-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide.
| Compound Name | N-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 124895371 |
| Molecular Formula | C13H19FN4O3S |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC[C@@H]1CO[C@H]2CN(c3ncc(F)cn3)C[C@@H]12 |
| InChI | InChI=1S/C13H19FN4O3S/c1-2-22(19,20)17-3-9-8-21-12-7-18(6-11(9)12)13-15-4-10(14)5-16-13/h4-5,9,11-12,17H,2-3,6-8H2,1H3/t9-,11+,12+/m1/s1 |
| InChIKey | HXAOYDJRZIAMHD-USWWRNFRSA-N |
| XLogP | 0.01 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |