C17H10Cl2FN3OS — CID 1248967
(5R)-2-(3,4-dichlorophenyl)-5-(3-fluorophenyl)-5,6-dihydro-[1,2,4]triazolo[5,1-b][1,3]thiazin-7-one (PubChem CID 1248967) has the molecular formula C17H10Cl2FN3OS and a molecular weight of 394.26 g/mol. Its IUPAC name is (5R)-2-(3,4-dichlorophenyl)-5-(3-fluorophenyl)-5,6-dihydro-[1,2,4]triazolo[5,1-b][1,3]thiazin-7-one.
| Compound Name | (5R)-2-(3,4-dichlorophenyl)-5-(3-fluorophenyl)-5,6-dihydro-[1,2,4]triazolo[5,1-b][1,3]thiazin-7-one |
|---|---|
| PubChem CID | 1248967 |
| Molecular Formula | C17H10Cl2FN3OS |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | (5R)-2-(3,4-dichlorophenyl)-5-(3-fluorophenyl)-5,6-dihydro-[1,2,4]triazolo[5,1-b][1,3]thiazin-7-one |
| SMILES | O=C1C[C@H](c2cccc(F)c2)Sc2nc(-c3ccc(Cl)c(Cl)c3)nn21 |
| InChI | InChI=1S/C17H10Cl2FN3OS/c18-12-5-4-10(7-13(12)19)16-21-17-23(22-16)15(24)8-14(25-17)9-2-1-3-11(20)6-9/h1-7,14H,8H2/t14-/m1/s1 |
| InChIKey | MMKBNXUZWCEREE-CQSZACIVSA-N |
| XLogP | 5.27 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |