C32H48O2 — CID 124898761
(3S,8S,9S,10R,13R,14R,17S)-17-[(2R,6S)-6-hydroxy-6-phenylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 124898761) has the molecular formula C32H48O2 and a molecular weight of 464.73 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14R,17S)-17-[(2R,6S)-6-hydroxy-6-phenylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14R,17S)-17-[(2R,6S)-6-hydroxy-6-phenylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 124898761 |
| Molecular Formula | C32H48O2 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 464.37 |
| IUPAC Name | (3S,8S,9S,10R,13R,14R,17S)-17-[(2R,6S)-6-hydroxy-6-phenylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CCC[C@](C)(O)c1ccccc1)[C@@H]1CC[C@@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C32H48O2/c1-22(9-8-18-32(4,34)23-10-6-5-7-11-23)27-14-15-28-26-13-12-24-21-25(33)16-19-30(24,2)29(26)17-20-31(27,28)3/h5-7,10-12,22,25-29,33-34H,8-9,13-21H2,1-4H3/t22-,25+,26+,27+,28-,29+,30+,31-,32+/m1/s1 |
| InChIKey | UUJFMJBANZOMSO-QRAOYRIYSA-N |
| XLogP | 7.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|