C22H32O3 — CID 124898932
(5R,8S,9S,10R,13S,14R,17R)-10,13-dimethyl-17-[(2S)-2-methyloxiran-2-yl]-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione (PubChem CID 124898932) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (5R,8S,9S,10R,13S,14R,17R)-10,13-dimethyl-17-[(2S)-2-methyloxiran-2-yl]-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione.
| Compound Name | (5R,8S,9S,10R,13S,14R,17R)-10,13-dimethyl-17-[(2S)-2-methyloxiran-2-yl]-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
|---|---|
| PubChem CID | 124898932 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (5R,8S,9S,10R,13S,14R,17R)-10,13-dimethyl-17-[(2S)-2-methyloxiran-2-yl]-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC(=O)[C@@H]4CC(=O)CC[C@@]43C)[C@H]1CC[C@H]2[C@@]1(C)CO1 |
| InChI | InChI=1S/C22H32O3/c1-20-8-6-13(23)10-17(20)18(24)11-14-15-4-5-19(22(3)12-25-22)21(15,2)9-7-16(14)20/h14-17,19H,4-12H2,1-3H3/t14-,15+,16-,17-,19+,20+,21-,22+/m0/s1 |
| InChIKey | MXNIOJVTFHRXCI-MTHACQSLSA-N |
| XLogP | 4.18 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|