C22H34O5 — CID 124903726
(3S,4R,5R,10R,11R,13S,14S,17R)-3,11-dihydroxy-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-4-carboxylic acid (PubChem CID 124903726) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is (3S,4R,5R,10R,11R,13S,14S,17R)-3,11-dihydroxy-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-4-carboxylic acid.
| Compound Name | (3S,4R,5R,10R,11R,13S,14S,17R)-3,11-dihydroxy-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-4-carboxylic acid |
|---|---|
| PubChem CID | 124903726 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (3S,4R,5R,10R,11R,13S,14S,17R)-3,11-dihydroxy-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-4-carboxylic acid |
| SMILES | C[C@H](O)[C@@H]1CC[C@@H]2C3=C([C@H](O)C[C@@]21C)[C@]1(C)CC[C@H](O)[C@H](C(=O)O)[C@H]1CC3 |
| InChI | InChI=1S/C22H34O5/c1-11(23)13-6-7-14-12-4-5-15-18(20(26)27)16(24)8-9-21(15,2)19(12)17(25)10-22(13,14)3/h11,13-18,23-25H,4-10H2,1-3H3,(H,26,27)/t11-,13-,14+,15+,16-,17+,18+,21+,22+/m0/s1 |
| InChIKey | ZHDGKAOGMGOSPM-ISJGVFETSA-N |
| XLogP | 2.73 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|