C24H35N3O4 — CID 124905514
[[(5S,8R,9S,10S,13R,14R,17R)-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]urea (PubChem CID 124905514) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is [[(5S,8R,9S,10S,13R,14R,17R)-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]urea.
| Compound Name | [[(5S,8R,9S,10S,13R,14R,17R)-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]urea |
|---|---|
| PubChem CID | 124905514 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | [[(5S,8R,9S,10S,13R,14R,17R)-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-2,4,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]urea |
| SMILES | C[C@]12CCC(=NNC(N)=O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](C3=CC(=O)OC3)CC[C@@]12O |
| InChI | InChI=1S/C24H35N3O4/c1-22-8-5-16(26-27-21(25)29)12-15(22)3-4-19-18(22)6-9-23(2)17(7-10-24(19,23)30)14-11-20(28)31-13-14/h11,15,17-19,30H,3-10,12-13H2,1-2H3,(H3,25,27,29)/t15-,17+,18-,19+,22-,23+,24+/m0/s1 |
| InChIKey | DIPDIMZUFOWZMF-IUVLNQRKSA-N |
| XLogP | 3.27 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|