C29H46O7 — CID 124907364
methyl (4S)-4-[(3S,5R,7R,8S,9R,10S,12R,13S,14R,17S)-3,7-diacetyloxy-12-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 124907364) has the molecular formula C29H46O7 and a molecular weight of 506.68 g/mol. Its IUPAC name is methyl (4S)-4-[(3S,5R,7R,8S,9R,10S,12R,13S,14R,17S)-3,7-diacetyloxy-12-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4S)-4-[(3S,5R,7R,8S,9R,10S,12R,13S,14R,17S)-3,7-diacetyloxy-12-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 124907364 |
| Molecular Formula | C29H46O7 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | methyl (4S)-4-[(3S,5R,7R,8S,9R,10S,12R,13S,14R,17S)-3,7-diacetyloxy-12-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@H](C)[C@@H]1CC[C@@H]2[C@@H]3[C@@H](C[C@@H](O)[C@]21C)[C@@]1(C)CC[C@H](OC(C)=O)C[C@@H]1C[C@H]3OC(C)=O |
| InChI | InChI=1S/C29H46O7/c1-16(7-10-26(33)34-6)21-8-9-22-27-23(15-25(32)29(21,22)5)28(4)12-11-20(35-17(2)30)13-19(28)14-24(27)36-18(3)31/h16,19-25,27,32H,7-15H2,1-6H3/t16-,19+,20-,21-,22+,23+,24+,25+,27+,28-,29-/m0/s1 |
| InChIKey | VKXXPYARELKQOY-AVFKCSARSA-N |
| XLogP | 4.68 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|