C12H24N4O2S — CID 124908441
N-[3-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]methanesulfonamide (PubChem CID 124908441) has the molecular formula C12H24N4O2S and a molecular weight of 288.42 g/mol. Its IUPAC name is N-[3-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]methanesulfonamide.
| Compound Name | N-[3-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 124908441 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-[3-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]methanesulfonamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1N1CN=C(NS(C)(=O)=O)NC1 |
| InChI | InChI=1S/C12H24N4O2S/c1-9-5-4-6-11(10(9)2)16-7-13-12(14-8-16)15-19(3,17)18/h9-11H,4-8H2,1-3H3,(H2,13,14,15)/t9-,10+,11-/m1/s1 |
| InChIKey | OZPLGMFKXGJMJB-OUAUKWLOSA-N |
| XLogP | 0.54 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |