About (3E)-2-benzyl-3-(dimethylaminomethylidene)-1,1-dioxothieno[2,3-e]thiazin-4-one
(3E)-2-benzyl-3-(dimethylaminomethylidene)-1,1-dioxothieno[2,3-e]thiazin-4-one (PubChem CID 124908518) has the molecular formula C16H16N2O3S2
and a molecular weight of 348.45 g/mol. Its IUPAC name is (3E)-2-benzyl-3-(dimethylaminomethylidene)-1,1-dioxothieno[2,3-e]thiazin-4-one.
Molecular Properties
| Compound Name | (3E)-2-benzyl-3-(dimethylaminomethylidene)-1,1-dioxothieno[2,3-e]thiazin-4-one |
| PubChem CID | 124908518 |
| Molecular Formula | C16H16N2O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | (3E)-2-benzyl-3-(dimethylaminomethylidene)-1,1-dioxothieno[2,3-e]thiazin-4-one |
| SMILES | CN(C)/C=C1\C(=O)c2sccc2S(=O)(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H16N2O3S2/c1-17(2)11-13-15(19)16-14(8-9-22-16)23(20,21)18(13)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3/b13-11+ |
| InChIKey | PYPUZDDBAIDNKB-ACCUITESSA-N |
| XLogP | 2.54 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-2-benzyl-3-(dimethylaminomethylidene)-1,1-dioxothieno[2,3-e]thiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-2-benzyl-3-(dimethylaminomethylidene)-1,1-dioxothieno[2,3-e]thiazin-4-one?
The IUPAC name of (3E)-2-benzyl-3-(dimethylaminomethylidene)-1,1-dioxothieno[2,3-e]thiazin-4-one (CID 124908518) is (3E)-2-benzyl-3-(dimethylaminomethylidene)-1,1-dioxothieno[2,3-e]thiazin-4-one.
What is the SMILES notation for (3E)-2-benzyl-3-(dimethylaminomethylidene)-1,1-dioxothieno[2,3-e]thiazin-4-one?
The canonical SMILES for (3E)-2-benzyl-3-(dimethylaminomethylidene)-1,1-dioxothieno[2,3-e]thiazin-4-one is CN(C)/C=C1\C(=O)c2sccc2S(=O)(=O)N1Cc1ccccc1.
What is the InChIKey of (3E)-2-benzyl-3-(dimethylaminomethylidene)-1,1-dioxothieno[2,3-e]thiazin-4-one?
The InChIKey is PYPUZDDBAIDNKB-ACCUITESSA-N. The full InChI is InChI=1S/C16H16N2O3S2/c1-17(2)11-13-15(19)16-14(8-9-22-16)23(20,21)18(13)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3/b13-11+.
What are the key properties of (3E)-2-benzyl-3-(dimethylaminomethylidene)-1,1-dioxothieno[2,3-e]thiazin-4-one?
(3E)-2-benzyl-3-(dimethylaminomethylidene)-1,1-dioxothieno[2,3-e]thiazin-4-one has a molecular weight of 348.45 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-2-benzyl-3-(dimethylaminomethylidene)-1,1-dioxothieno[2,3-e]thiazin-4-one is sourced from PubChem (CID 124908518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).