C21H17BrN2O3 — CID 124908706
(1R,2R,6R,7R)-4-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 124908706) has the molecular formula C21H17BrN2O3 and a molecular weight of 425.28 g/mol. Its IUPAC name is (1R,2R,6R,7R)-4-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7R)-4-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 124908706 |
| Molecular Formula | C21H17BrN2O3 |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | (1R,2R,6R,7R)-4-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | O=C1[C@H]2[C@H](C(=O)N1/N=C\c1ccc(-c3ccc(Br)cc3)o1)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C21H17BrN2O3/c22-15-7-5-12(6-8-15)17-10-9-16(27-17)11-23-24-20(25)18-13-1-2-14(4-3-13)19(18)21(24)26/h1-2,5-11,13-14,18-19H,3-4H2/b23-11-/t13-,14-,18+,19+/m0/s1 |
| InChIKey | SRNMEHJLNUDWHV-LDTBZDQCSA-N |
| XLogP | 4.24 |
| TPSA | 62.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|