C20H26 — CID 124909424
(1R,4S,7R,10S)-2-[(1R,4R,7R,10R)-2-tricyclo[5.2.1.04,10]dec-2-enyl]tricyclo[5.2.1.04,10]dec-2-ene (PubChem CID 124909424) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is (1R,4S,7R,10S)-2-[(1R,4R,7R,10R)-2-tricyclo[5.2.1.04,10]dec-2-enyl]tricyclo[5.2.1.04,10]dec-2-ene.
| Compound Name | (1R,4S,7R,10S)-2-[(1R,4R,7R,10R)-2-tricyclo[5.2.1.04,10]dec-2-enyl]tricyclo[5.2.1.04,10]dec-2-ene |
|---|---|
| PubChem CID | 124909424 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | (1R,4S,7R,10S)-2-[(1R,4R,7R,10R)-2-tricyclo[5.2.1.04,10]dec-2-enyl]tricyclo[5.2.1.04,10]dec-2-ene |
| SMILES | C1=C(C2=C[C@H]3CC[C@@H]4CC[C@@H]2[C@@H]43)[C@@H]2CC[C@H]3CC[C@@H]1[C@@H]32 |
| InChI | InChI=1S/C20H26/c1-3-13-9-17(15-7-5-11(1)19(13)15)18-10-14-4-2-12-6-8-16(18)20(12)14/h9-16,19-20H,1-8H2/t11-,12-,13-,14+,15+,16+,19+,20-/m1/s1 |
| InChIKey | CHNDIBFBKLOVKW-RJLXXNIUSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |