C16H26N4OS — CID 124911160
4-[[(3aR,4S,7aR)-2-(thiadiazol-4-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]morpholine (PubChem CID 124911160) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is 4-[[(3aR,4S,7aR)-2-(thiadiazol-4-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]morpholine.
| Compound Name | 4-[[(3aR,4S,7aR)-2-(thiadiazol-4-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]morpholine |
|---|---|
| PubChem CID | 124911160 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 4-[[(3aR,4S,7aR)-2-(thiadiazol-4-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]morpholine |
| SMILES | c1snnc1CN1C[C@@H]2CCC[C@H](CN3CCOCC3)[C@@H]2C1 |
| InChI | InChI=1S/C16H26N4OS/c1-2-13(8-19-4-6-21-7-5-19)16-11-20(9-14(16)3-1)10-15-12-22-18-17-15/h12-14,16H,1-11H2/t13-,14+,16+/m1/s1 |
| InChIKey | JKOLFMFWOBEROS-YCPHGPKFSA-N |
| XLogP | 1.72 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |