C20H25N3O — CID 124911446
(5aS,9aR)-8-phenyl-4-(pyridin-4-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine (PubChem CID 124911446) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (5aS,9aR)-8-phenyl-4-(pyridin-4-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine.
| Compound Name | (5aS,9aR)-8-phenyl-4-(pyridin-4-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine |
|---|---|
| PubChem CID | 124911446 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (5aS,9aR)-8-phenyl-4-(pyridin-4-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine |
| SMILES | c1ccc(N2CC[C@H]3CN(Cc4ccncc4)CCO[C@H]3C2)cc1 |
| InChI | InChI=1S/C20H25N3O/c1-2-4-19(5-3-1)23-11-8-18-15-22(12-13-24-20(18)16-23)14-17-6-9-21-10-7-17/h1-7,9-10,18,20H,8,11-16H2/t18-,20-/m0/s1 |
| InChIKey | OFWUCLJYNJLBEK-ICSRJNTNSA-N |
| XLogP | 2.81 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |