C23H33N3O3 — CID 124911699
(1'S,2S,2'R,4'R)-N-[2-(diethylamino)ethyl]-1'-methyl-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide (PubChem CID 124911699) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is (1'S,2S,2'R,4'R)-N-[2-(diethylamino)ethyl]-1'-methyl-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide.
| Compound Name | (1'S,2S,2'R,4'R)-N-[2-(diethylamino)ethyl]-1'-methyl-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
|---|---|
| PubChem CID | 124911699 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | (1'S,2S,2'R,4'R)-N-[2-(diethylamino)ethyl]-1'-methyl-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
| SMILES | CCN(CC)CCNC(=O)[C@@H]1C[C@H]2CC[C@@]1(C)C[C@@]21NC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C23H33N3O3/c1-4-26(5-2)13-12-24-21(28)18-14-16-10-11-22(18,3)15-23(16)25-20(27)17-8-6-7-9-19(17)29-23/h6-9,16,18H,4-5,10-15H2,1-3H3,(H,24,28)(H,25,27)/t16-,18+,22+,23+/m1/s1 |
| InChIKey | SBJVCDHWJCQQIQ-YAPKBZITSA-N |
| XLogP | 2.79 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |