C21H24N4O2S — CID 124911847
(1'S,2R,2'S,4'S)-1'-methyl-4-oxo-N-(thiophen-2-ylmethyl)spiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide (PubChem CID 124911847) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is (1'S,2R,2'S,4'S)-1'-methyl-4-oxo-N-(thiophen-2-ylmethyl)spiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide.
| Compound Name | (1'S,2R,2'S,4'S)-1'-methyl-4-oxo-N-(thiophen-2-ylmethyl)spiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
|---|---|
| PubChem CID | 124911847 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (1'S,2R,2'S,4'S)-1'-methyl-4-oxo-N-(thiophen-2-ylmethyl)spiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
| SMILES | C[C@@]12CC[C@@H](C[C@@H]1C(=O)NCc1cccs1)[C@@]1(C2)NC(=O)c2cccnc2N1 |
| InChI | InChI=1S/C21H24N4O2S/c1-20-7-6-13(10-16(20)19(27)23-11-14-4-3-9-28-14)21(12-20)24-17-15(18(26)25-21)5-2-8-22-17/h2-5,8-9,13,16H,6-7,10-12H2,1H3,(H,22,24)(H,23,27)(H,25,26)/t13-,16+,20-,21+/m0/s1 |
| InChIKey | VECUBBRPFNSCKN-MWYMOKJQSA-N |
| XLogP | 3.14 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |