C18H27N3O2 — CID 124911975
(7R)-7-(morpholin-4-ylmethyl)-2-(pyridin-3-ylmethyl)-5-oxa-2-azaspiro[3.5]nonane (PubChem CID 124911975) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is (7R)-7-(morpholin-4-ylmethyl)-2-(pyridin-3-ylmethyl)-5-oxa-2-azaspiro[3.5]nonane.
| Compound Name | (7R)-7-(morpholin-4-ylmethyl)-2-(pyridin-3-ylmethyl)-5-oxa-2-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 124911975 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | (7R)-7-(morpholin-4-ylmethyl)-2-(pyridin-3-ylmethyl)-5-oxa-2-azaspiro[3.5]nonane |
| SMILES | c1cncc(CN2CC3(CC[C@H](CN4CCOCC4)CO3)C2)c1 |
| InChI | InChI=1S/C18H27N3O2/c1-2-16(10-19-5-1)11-21-14-18(15-21)4-3-17(13-23-18)12-20-6-8-22-9-7-20/h1-2,5,10,17H,3-4,6-9,11-15H2/t17-/m1/s1 |
| InChIKey | XMTJRWQNHBBODE-QGZVFWFLSA-N |
| XLogP | 1.39 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |