C18H22N2O2S — CID 124912698
(3R,3aR,6aR)-5-[(3-methylthiophen-2-yl)methyl]-3-(pyridin-4-yloxymethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 124912698) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is (3R,3aR,6aR)-5-[(3-methylthiophen-2-yl)methyl]-3-(pyridin-4-yloxymethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | (3R,3aR,6aR)-5-[(3-methylthiophen-2-yl)methyl]-3-(pyridin-4-yloxymethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 124912698 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (3R,3aR,6aR)-5-[(3-methylthiophen-2-yl)methyl]-3-(pyridin-4-yloxymethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | Cc1ccsc1CN1C[C@H]2[C@@H](COc3ccncc3)CO[C@H]2C1 |
| InChI | InChI=1S/C18H22N2O2S/c1-13-4-7-23-18(13)10-20-8-16-14(12-22-17(16)9-20)11-21-15-2-5-19-6-3-15/h2-7,14,16-17H,8-12H2,1H3/t14-,16-,17-/m0/s1 |
| InChIKey | ZFNCDBKVEXEACW-XIRDDKMYSA-N |
| XLogP | 2.98 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |