C18H25N5O — CID 124912986
(3aS,4S,6aR)-2',3'-diethyl-2-(5-methylpyrimidin-2-yl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-imidazole]-4'-one (PubChem CID 124912986) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is (3aS,4S,6aR)-2',3'-diethyl-2-(5-methylpyrimidin-2-yl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-imidazole]-4'-one.
| Compound Name | (3aS,4S,6aR)-2',3'-diethyl-2-(5-methylpyrimidin-2-yl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-imidazole]-4'-one |
|---|---|
| PubChem CID | 124912986 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | (3aS,4S,6aR)-2',3'-diethyl-2-(5-methylpyrimidin-2-yl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,5'-imidazole]-4'-one |
| SMILES | CCC1=N[C@]2(CC[C@H]3CN(c4ncc(C)cn4)C[C@H]32)C(=O)N1CC |
| InChI | InChI=1S/C18H25N5O/c1-4-15-21-18(16(24)23(15)5-2)7-6-13-10-22(11-14(13)18)17-19-8-12(3)9-20-17/h8-9,13-14H,4-7,10-11H2,1-3H3/t13-,14+,18-/m0/s1 |
| InChIKey | VMCZDSKFIKDZSO-IYOUNJFTSA-N |
| XLogP | 2.04 |
| TPSA | 61.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |