C17H24N2O4S — CID 124914000
(3aS,6R,7aS)-4-(4-ethylphenyl)sulfonyl-N-methyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide (PubChem CID 124914000) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is (3aS,6R,7aS)-4-(4-ethylphenyl)sulfonyl-N-methyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide.
| Compound Name | (3aS,6R,7aS)-4-(4-ethylphenyl)sulfonyl-N-methyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 124914000 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (3aS,6R,7aS)-4-(4-ethylphenyl)sulfonyl-N-methyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
| SMILES | CCc1ccc(S(=O)(=O)N2C[C@H](C(=O)NC)C[C@@H]3OCC[C@@H]32)cc1 |
| InChI | InChI=1S/C17H24N2O4S/c1-3-12-4-6-14(7-5-12)24(21,22)19-11-13(17(20)18-2)10-16-15(19)8-9-23-16/h4-7,13,15-16H,3,8-11H2,1-2H3,(H,18,20)/t13-,15+,16+/m1/s1 |
| InChIKey | VCKJZPKXUIGRBI-KBMXLJTQSA-N |
| XLogP | 1.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |