C15H14Br2O6 — CID 124914291
methyl (3R,4S)-6,8-dibromo-4-[(2R)-1-methoxy-1-oxopropan-2-yl]-2-oxo-3,4-dihydrochromene-3-carboxylate (PubChem CID 124914291) has the molecular formula C15H14Br2O6 and a molecular weight of 450.08 g/mol. Its IUPAC name is methyl (3R,4S)-6,8-dibromo-4-[(2R)-1-methoxy-1-oxopropan-2-yl]-2-oxo-3,4-dihydrochromene-3-carboxylate.
| Compound Name | methyl (3R,4S)-6,8-dibromo-4-[(2R)-1-methoxy-1-oxopropan-2-yl]-2-oxo-3,4-dihydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 124914291 |
| Molecular Formula | C15H14Br2O6 |
| Molecular Weight | 450.08 g/mol |
| Exact Mass | 447.92 |
| IUPAC Name | methyl (3R,4S)-6,8-dibromo-4-[(2R)-1-methoxy-1-oxopropan-2-yl]-2-oxo-3,4-dihydrochromene-3-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)Oc2c(Br)cc(Br)cc2[C@H]1[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C15H14Br2O6/c1-6(13(18)21-2)10-8-4-7(16)5-9(17)12(8)23-15(20)11(10)14(19)22-3/h4-6,10-11H,1-3H3/t6-,10-,11-/m1/s1 |
| InChIKey | WTTLFVLYQYOQPQ-DIMCTHFVSA-N |
| XLogP | 2.81 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.08 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|