C16H16O — CID 124916174
(1R,2R,4R,7S,10R)-9-phenyltricyclo[5.2.1.04,10]deca-5,8-dien-2-ol (PubChem CID 124916174) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is (1R,2R,4R,7S,10R)-9-phenyltricyclo[5.2.1.04,10]deca-5,8-dien-2-ol.
| Compound Name | (1R,2R,4R,7S,10R)-9-phenyltricyclo[5.2.1.04,10]deca-5,8-dien-2-ol |
|---|---|
| PubChem CID | 124916174 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (1R,2R,4R,7S,10R)-9-phenyltricyclo[5.2.1.04,10]deca-5,8-dien-2-ol |
| SMILES | O[C@@H]1C[C@@H]2C=C[C@@H]3C=C(c4ccccc4)[C@H]1[C@@H]32 |
| InChI | InChI=1S/C16H16O/c17-14-9-12-7-6-11-8-13(16(14)15(11)12)10-4-2-1-3-5-10/h1-8,11-12,14-17H,9H2/t11-,12+,14-,15+,16-/m1/s1 |
| InChIKey | CFWGFWXYQMMSFE-XHXGSEDSSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|