C24H42N2O3 — CID 124916341
(4S)-4-[(3S,5R,7R,8S,9R,10S,13S,14R,17S)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanehydrazide (PubChem CID 124916341) has the molecular formula C24H42N2O3 and a molecular weight of 406.61 g/mol. Its IUPAC name is (4S)-4-[(3S,5R,7R,8S,9R,10S,13S,14R,17S)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanehydrazide.
| Compound Name | (4S)-4-[(3S,5R,7R,8S,9R,10S,13S,14R,17S)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanehydrazide |
|---|---|
| PubChem CID | 124916341 |
| Molecular Formula | C24H42N2O3 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | (4S)-4-[(3S,5R,7R,8S,9R,10S,13S,14R,17S)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanehydrazide |
| SMILES | C[C@@H](CCC(=O)NN)[C@@H]1CC[C@@H]2[C@H]3[C@H](O)C[C@H]4C[C@@H](O)CC[C@]4(C)[C@@H]3CC[C@]21C |
| InChI | InChI=1S/C24H42N2O3/c1-14(4-7-21(29)26-25)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(27)12-15(23)13-20(22)28/h14-20,22,27-28H,4-13,25H2,1-3H3,(H,26,29)/t14-,15+,16-,17-,18+,19+,20+,22+,23-,24-/m0/s1 |
| InChIKey | YZPBDMRZRBJWSE-PZNFNJKJSA-N |
| XLogP | 3.38 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|