C20H26O5 — CID 124916515
[(1S,2S,6R,8S,11S,12R,15S,16S)-2-hydroxy-16-methyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-3-en-15-yl] acetate (PubChem CID 124916515) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is [(1S,2S,6R,8S,11S,12R,15S,16S)-2-hydroxy-16-methyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-3-en-15-yl] acetate.
| Compound Name | [(1S,2S,6R,8S,11S,12R,15S,16S)-2-hydroxy-16-methyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-3-en-15-yl] acetate |
|---|---|
| PubChem CID | 124916515 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [(1S,2S,6R,8S,11S,12R,15S,16S)-2-hydroxy-16-methyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-3-en-15-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@H]2[C@@H]3CC[C@]45O[C@H]4C(=O)C=C[C@]5(O)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H26O5/c1-11(21)24-16-4-3-13-12-5-10-20-17(25-20)15(22)7-9-19(20,23)14(12)6-8-18(13,16)2/h7,9,12-14,16-17,23H,3-6,8,10H2,1-2H3/t12-,13+,14-,16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | GSTJTUIKTZSOQN-SMTUCEMLSA-N |
| XLogP | 2.16 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|