C13H18NO2P — CID 124919423
(2R,3S)-3-ethoxy-1,5-dimethyl-2-phenyl-2H-1,3λ5-azaphosphole 3-oxide (PubChem CID 124919423) has the molecular formula C13H18NO2P and a molecular weight of 251.27 g/mol. Its IUPAC name is (2R,3S)-3-ethoxy-1,5-dimethyl-2-phenyl-2H-1,3λ5-azaphosphole 3-oxide.
| Compound Name | (2R,3S)-3-ethoxy-1,5-dimethyl-2-phenyl-2H-1,3λ5-azaphosphole 3-oxide |
|---|---|
| PubChem CID | 124919423 |
| Molecular Formula | C13H18NO2P |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (2R,3S)-3-ethoxy-1,5-dimethyl-2-phenyl-2H-1,3λ5-azaphosphole 3-oxide |
| SMILES | CCO[P@@]1(=O)C=C(C)N(C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C13H18NO2P/c1-4-16-17(15)10-11(2)14(3)13(17)12-8-6-5-7-9-12/h5-10,13H,4H2,1-3H3/t13-,17+/m1/s1 |
| InChIKey | QOLMNTZCLSEOSB-DYVFJYSZSA-N |
| XLogP | 3.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|