C16H10N4O2 — CID 124919456
methyl (1R,4S,7R,10R)-5,5,6,6-tetracyanotricyclo[5.2.1.04,10]deca-2,8-diene-2-carboxylate (PubChem CID 124919456) has the molecular formula C16H10N4O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is methyl (1R,4S,7R,10R)-5,5,6,6-tetracyanotricyclo[5.2.1.04,10]deca-2,8-diene-2-carboxylate.
| Compound Name | methyl (1R,4S,7R,10R)-5,5,6,6-tetracyanotricyclo[5.2.1.04,10]deca-2,8-diene-2-carboxylate |
|---|---|
| PubChem CID | 124919456 |
| Molecular Formula | C16H10N4O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | methyl (1R,4S,7R,10R)-5,5,6,6-tetracyanotricyclo[5.2.1.04,10]deca-2,8-diene-2-carboxylate |
| SMILES | COC(=O)C1=C[C@@H]2[C@H]3[C@@H](C=C[C@@H]13)C(C#N)(C#N)C2(C#N)C#N |
| InChI | InChI=1S/C16H10N4O2/c1-22-14(21)10-4-12-13-9(10)2-3-11(13)15(5-17,6-18)16(12,7-19)8-20/h2-4,9,11-13H,1H3/t9-,11+,12+,13+/m0/s1 |
| InChIKey | BHUXPMIGPXBCNJ-WKSBVSIWSA-N |
| XLogP | 1.21 |
| TPSA | 121.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|