C17H17Cl4NO4 — CID 124919552
(1R,2S,3S,6S,7S,8S,9R,13S)-11-[(2S)-butan-2-yl]oxy-3,4,5,6-tetrachloro-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione (PubChem CID 124919552) has the molecular formula C17H17Cl4NO4 and a molecular weight of 441.14 g/mol. Its IUPAC name is (1R,2S,3S,6S,7S,8S,9R,13S)-11-[(2S)-butan-2-yl]oxy-3,4,5,6-tetrachloro-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione.
| Compound Name | (1R,2S,3S,6S,7S,8S,9R,13S)-11-[(2S)-butan-2-yl]oxy-3,4,5,6-tetrachloro-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
|---|---|
| PubChem CID | 124919552 |
| Molecular Formula | C17H17Cl4NO4 |
| Molecular Weight | 441.14 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | (1R,2S,3S,6S,7S,8S,9R,13S)-11-[(2S)-butan-2-yl]oxy-3,4,5,6-tetrachloro-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
| SMILES | CC[C@H](C)ON1C(=O)[C@@H]2[C@H]3O[C@@H]([C@@H]2C1=O)[C@@H]1[C@@H]3[C@@]2(Cl)C[C@@]1(Cl)C(Cl)=C2Cl |
| InChI | InChI=1S/C17H17Cl4NO4/c1-3-5(2)26-22-14(23)6-7(15(22)24)11-9-8(10(6)25-11)16(20)4-17(9,21)13(19)12(16)18/h5-11H,3-4H2,1-2H3/t5-,6-,7+,8-,9-,10+,11-,16-,17-/m0/s1 |
| InChIKey | WAIHBPBIDSIKNI-ZJEUPMJWSA-N |
| XLogP | 3.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.14 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|