C27H37ClO5 — CID 124920582
[(3S,8R,9S,10S,13R,14R,17R)-17-acetyl-17-acetyloxy-6-chloro-10,13-dimethyl-1,2,3,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl] butanoate (PubChem CID 124920582) has the molecular formula C27H37ClO5 and a molecular weight of 477.04 g/mol. Its IUPAC name is [(3S,8R,9S,10S,13R,14R,17R)-17-acetyl-17-acetyloxy-6-chloro-10,13-dimethyl-1,2,3,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl] butanoate.
| Compound Name | [(3S,8R,9S,10S,13R,14R,17R)-17-acetyl-17-acetyloxy-6-chloro-10,13-dimethyl-1,2,3,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl] butanoate |
|---|---|
| PubChem CID | 124920582 |
| Molecular Formula | C27H37ClO5 |
| Molecular Weight | 477.04 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | [(3S,8R,9S,10S,13R,14R,17R)-17-acetyl-17-acetyloxy-6-chloro-10,13-dimethyl-1,2,3,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1C=C2C(Cl)=C[C@H]3[C@H]4CC[C@](OC(C)=O)(C(C)=O)[C@]4(C)CC[C@@H]3[C@]2(C)CC1 |
| InChI | InChI=1S/C27H37ClO5/c1-6-7-24(31)32-18-8-11-25(4)20-9-12-26(5)21(19(20)15-23(28)22(25)14-18)10-13-27(26,16(2)29)33-17(3)30/h14-15,18-21H,6-13H2,1-5H3/t18-,19+,20-,21+,25-,26+,27-/m0/s1 |
| InChIKey | WMNKNTNQPACBNC-DJZYFREWSA-N |
| XLogP | 5.89 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.04 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |