C12H12Cl2 — CID 124920621
(1S,2R,5R,6S,7R,8R,9S,10S)-8,9-dichlorotetracyclo[4.4.2.02,5.07,10]dodeca-3,11-diene (PubChem CID 124920621) has the molecular formula C12H12Cl2 and a molecular weight of 227.13 g/mol. Its IUPAC name is (1S,2R,5R,6S,7R,8R,9S,10S)-8,9-dichlorotetracyclo[4.4.2.02,5.07,10]dodeca-3,11-diene.
| Compound Name | (1S,2R,5R,6S,7R,8R,9S,10S)-8,9-dichlorotetracyclo[4.4.2.02,5.07,10]dodeca-3,11-diene |
|---|---|
| PubChem CID | 124920621 |
| Molecular Formula | C12H12Cl2 |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | (1S,2R,5R,6S,7R,8R,9S,10S)-8,9-dichlorotetracyclo[4.4.2.02,5.07,10]dodeca-3,11-diene |
| SMILES | Cl[C@@H]1[C@H](Cl)[C@@H]2[C@H]3C=C[C@@H]([C@@H]4C=C[C@H]43)[C@H]12 |
| InChI | InChI=1S/C12H12Cl2/c13-11-9-7-3-4-8(10(9)12(11)14)6-2-1-5(6)7/h1-12H/t5-,6-,7+,8+,9-,10+,11-,12+/m1/s1 |
| InChIKey | XHVCLSVMXDWLKI-KMFRLLODSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|