C14H14O2 — CID 124921984
(1R,5R,8R,12R)-15,16-dioxapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,9-triene (PubChem CID 124921984) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is (1R,5R,8R,12R)-15,16-dioxapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,9-triene.
| Compound Name | (1R,5R,8R,12R)-15,16-dioxapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,9-triene |
|---|---|
| PubChem CID | 124921984 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (1R,5R,8R,12R)-15,16-dioxapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,9-triene |
| SMILES | c1c2c(cc3c1[C@H]1CC[C@H]3O1)[C@H]1CC[C@H]2O1 |
| InChI | InChI=1S/C14H14O2/c1-2-12-8-6-10-9(5-7(8)11(1)15-12)13-3-4-14(10)16-13/h5-6,11-14H,1-4H2/t11-,12-,13-,14-/m1/s1 |
| InChIKey | VTFDVQAKALSSMI-AAVRWANBSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |