C12H8Br2Cl6 — CID 124922062
(1R,2S,3S,6S,7S,8R,9S,10S)-9,10-dibromo-3,4,5,6,12,12-hexachlorotetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 124922062) has the molecular formula C12H8Br2Cl6 and a molecular weight of 524.72 g/mol. Its IUPAC name is (1R,2S,3S,6S,7S,8R,9S,10S)-9,10-dibromo-3,4,5,6,12,12-hexachlorotetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | (1R,2S,3S,6S,7S,8R,9S,10S)-9,10-dibromo-3,4,5,6,12,12-hexachlorotetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 124922062 |
| Molecular Formula | C12H8Br2Cl6 |
| Molecular Weight | 524.72 g/mol |
| Exact Mass | 519.71 |
| IUPAC Name | (1R,2S,3S,6S,7S,8R,9S,10S)-9,10-dibromo-3,4,5,6,12,12-hexachlorotetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | ClC1=C(Cl)[C@@]2(Cl)[C@@H]3[C@H]4C[C@@H]([C@H](Br)[C@H]4Br)[C@H]3[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C12H8Br2Cl6/c13-6-2-1-3(7(6)14)5-4(2)10(17)8(15)9(16)11(5,18)12(10,19)20/h2-7H,1H2/t2-,3-,4-,5-,6+,7+,10+,11+/m1/s1 |
| InChIKey | SUSUGGDVAULJNM-JJZFUBORSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.72 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|