C14H14F2O3 — CID 124922374
2,2-difluoro-2-[(1S,2S,3R,4S,6S,7R,8R,9R,10S,12R)-6-methyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecan-4-yl]acetic acid (PubChem CID 124922374) has the molecular formula C14H14F2O3 and a molecular weight of 268.26 g/mol. Its IUPAC name is 2,2-difluoro-2-[(1S,2S,3R,4S,6S,7R,8R,9R,10S,12R)-6-methyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecan-4-yl]acetic acid.
| Compound Name | 2,2-difluoro-2-[(1S,2S,3R,4S,6S,7R,8R,9R,10S,12R)-6-methyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecan-4-yl]acetic acid |
|---|---|
| PubChem CID | 124922374 |
| Molecular Formula | C14H14F2O3 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2,2-difluoro-2-[(1S,2S,3R,4S,6S,7R,8R,9R,10S,12R)-6-methyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecan-4-yl]acetic acid |
| SMILES | C[C@@]12O[C@@]3(C(F)(F)C(=O)O)[C@@H]4[C@H]5C[C@@H]([C@@H]6[C@@H]5[C@@H]3[C@@H]61)[C@@H]42 |
| InChI | InChI=1S/C14H14F2O3/c1-12-7-3-2-4-6-5(3)9(12)10(6)13(19-12,8(4)7)14(15,16)11(17)18/h3-10H,2H2,1H3,(H,17,18)/t3-,4-,5+,6+,7-,8+,9+,10+,12-,13-/m0/s1 |
| InChIKey | ATJTZLAAUJOPGP-QTMOBWPZSA-N |
| XLogP | 1.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |