C10H14Br2S — CID 124922415
(1S,3R,4R,6R)-3,4-dibromo-8-thiatricyclo[4.3.2.01,6]undecane (PubChem CID 124922415) has the molecular formula C10H14Br2S and a molecular weight of 326.10 g/mol. Its IUPAC name is (1S,3R,4R,6R)-3,4-dibromo-8-thiatricyclo[4.3.2.01,6]undecane.
| Compound Name | (1S,3R,4R,6R)-3,4-dibromo-8-thiatricyclo[4.3.2.01,6]undecane |
|---|---|
| PubChem CID | 124922415 |
| Molecular Formula | C10H14Br2S |
| Molecular Weight | 326.10 g/mol |
| Exact Mass | 323.92 |
| IUPAC Name | (1S,3R,4R,6R)-3,4-dibromo-8-thiatricyclo[4.3.2.01,6]undecane |
| SMILES | Br[C@@H]1C[C@@]23CC[C@@]2(CSC3)C[C@H]1Br |
| InChI | InChI=1S/C10H14Br2S/c11-7-3-9-1-2-10(9,4-8(7)12)6-13-5-9/h7-8H,1-6H2/t7-,8-,9-,10+/m1/s1 |
| InChIKey | JVPIKUYAMFZXQP-KYXWUPHJSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.10 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|