C15H25N3O3 — CID 124922879
(1R,3R,9aR)-3-[(2R)-1-nitrosopiperidin-2-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carboxylic acid (PubChem CID 124922879) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is (1R,3R,9aR)-3-[(2R)-1-nitrosopiperidin-2-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carboxylic acid.
| Compound Name | (1R,3R,9aR)-3-[(2R)-1-nitrosopiperidin-2-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carboxylic acid |
|---|---|
| PubChem CID | 124922879 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (1R,3R,9aR)-3-[(2R)-1-nitrosopiperidin-2-yl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carboxylic acid |
| SMILES | O=NN1CCCC[C@@H]1[C@@H]1C[C@@H](C(=O)O)[C@H]2CCCCN2C1 |
| InChI | InChI=1S/C15H25N3O3/c19-15(20)12-9-11(10-17-7-3-1-6-14(12)17)13-5-2-4-8-18(13)16-21/h11-14H,1-10H2,(H,19,20)/t11-,12-,13-,14-/m1/s1 |
| InChIKey | QCMPSJONWHMZNJ-AAVRWANBSA-N |
| XLogP | 2.10 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|