C13H18O2 — CID 124922888
(1S,2S,4S,5R)-1,2,4,5,7,8-hexamethyl-3-oxatricyclo[3.3.0.02,4]oct-7-en-6-one (PubChem CID 124922888) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (1S,2S,4S,5R)-1,2,4,5,7,8-hexamethyl-3-oxatricyclo[3.3.0.02,4]oct-7-en-6-one.
| Compound Name | (1S,2S,4S,5R)-1,2,4,5,7,8-hexamethyl-3-oxatricyclo[3.3.0.02,4]oct-7-en-6-one |
|---|---|
| PubChem CID | 124922888 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (1S,2S,4S,5R)-1,2,4,5,7,8-hexamethyl-3-oxatricyclo[3.3.0.02,4]oct-7-en-6-one |
| SMILES | CC1=C(C)[C@]2(C)[C@]3(C)O[C@@]3(C)[C@]2(C)C1=O |
| InChI | InChI=1S/C13H18O2/c1-7-8(2)10(3)11(4,9(7)14)13(6)12(10,5)15-13/h1-6H3/t10-,11+,12-,13-/m0/s1 |
| InChIKey | LNOMNTVPMSFBPH-RNJOBUHISA-N |
| XLogP | 2.48 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|