C11H8Cl2O — CID 124923761
(1R,8R,9S,11R)-10,10-dichloro-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene (PubChem CID 124923761) has the molecular formula C11H8Cl2O and a molecular weight of 227.09 g/mol. Its IUPAC name is (1R,8R,9S,11R)-10,10-dichloro-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene.
| Compound Name | (1R,8R,9S,11R)-10,10-dichloro-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 124923761 |
| Molecular Formula | C11H8Cl2O |
| Molecular Weight | 227.09 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | (1R,8R,9S,11R)-10,10-dichloro-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene |
| SMILES | ClC1(Cl)[C@@H]2[C@H]1[C@H]1O[C@H]2c2ccccc21 |
| InChI | InChI=1S/C11H8Cl2O/c12-11(13)7-8(11)10-6-4-2-1-3-5(6)9(7)14-10/h1-4,7-10H/t7-,8+,9-,10-/m0/s1 |
| InChIKey | MCKIEIUOJSYDPH-JXUBOQSCSA-N |
| XLogP | 3.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.09 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|